C14H16F2N2O2 — CID 114693576
4-(difluoromethoxy)-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzamide (PubChem CID 114693576) has the molecular formula C14H16F2N2O2 and a molecular weight of 282.29 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzamide.
| Compound Name | 4-(difluoromethoxy)-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 114693576 |
| Molecular Formula | C14H16F2N2O2 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 4-(difluoromethoxy)-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzamide |
| SMILES | O=C(NCC1=CCNCC1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C14H16F2N2O2/c15-14(16)20-12-3-1-11(2-4-12)13(19)18-9-10-5-7-17-8-6-10/h1-5,14,17H,6-9H2,(H,18,19) |
| InChIKey | ADBSDWXHLAKPKM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|