C13H15F2NO3 — CID 78956822
4-(difluoromethoxy)-N-[(3-methyloxetan-3-yl)methyl]benzamide (PubChem CID 78956822) has the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[(3-methyloxetan-3-yl)methyl]benzamide.
| Compound Name | 4-(difluoromethoxy)-N-[(3-methyloxetan-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 78956822 |
| Molecular Formula | C13H15F2NO3 |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 4-(difluoromethoxy)-N-[(3-methyloxetan-3-yl)methyl]benzamide |
| SMILES | CC1(CNC(=O)c2ccc(OC(F)F)cc2)COC1 |
| InChI | InChI=1S/C13H15F2NO3/c1-13(7-18-8-13)6-16-11(17)9-2-4-10(5-3-9)19-12(14)15/h2-5,12H,6-8H2,1H3,(H,16,17) |
| InChIKey | BMUSZLINAPWEPL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |