C13H15Cl2NO3 — CID 78957615
3,5-dichloro-4-methoxy-N-[(3-methyloxetan-3-yl)methyl]benzamide (PubChem CID 78957615) has the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. Its IUPAC name is 3,5-dichloro-4-methoxy-N-[(3-methyloxetan-3-yl)methyl]benzamide.
| Compound Name | 3,5-dichloro-4-methoxy-N-[(3-methyloxetan-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 78957615 |
| Molecular Formula | C13H15Cl2NO3 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 3,5-dichloro-4-methoxy-N-[(3-methyloxetan-3-yl)methyl]benzamide |
| SMILES | COc1c(Cl)cc(C(=O)NCC2(C)COC2)cc1Cl |
| InChI | InChI=1S/C13H15Cl2NO3/c1-13(6-19-7-13)5-16-12(17)8-3-9(14)11(18-2)10(15)4-8/h3-4H,5-7H2,1-2H3,(H,16,17) |
| InChIKey | QROUWGIBMHJOPT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |