C13H15ClINO3 — CID 78957032
5-chloro-4-iodo-2-methoxy-N-[(3-methyloxetan-3-yl)methyl]benzamide (PubChem CID 78957032) has the molecular formula C13H15ClINO3 and a molecular weight of 395.62 g/mol. Its IUPAC name is 5-chloro-4-iodo-2-methoxy-N-[(3-methyloxetan-3-yl)methyl]benzamide.
| Compound Name | 5-chloro-4-iodo-2-methoxy-N-[(3-methyloxetan-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 78957032 |
| Molecular Formula | C13H15ClINO3 |
| Molecular Weight | 395.62 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | 5-chloro-4-iodo-2-methoxy-N-[(3-methyloxetan-3-yl)methyl]benzamide |
| SMILES | COc1cc(I)c(Cl)cc1C(=O)NCC1(C)COC1 |
| InChI | InChI=1S/C13H15ClINO3/c1-13(6-19-7-13)5-16-12(17)8-3-9(14)10(15)4-11(8)18-2/h3-4H,5-7H2,1-2H3,(H,16,17) |
| InChIKey | SEWOGTVMEYMCTG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.62 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|