C21H24N2O4 — CID 119067850
methyl 2-[4-[(3-hydroxypiperidin-3-yl)methylcarbamoyl]phenyl]benzoate (PubChem CID 119067850) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is methyl 2-[4-[(3-hydroxypiperidin-3-yl)methylcarbamoyl]phenyl]benzoate.
| Compound Name | methyl 2-[4-[(3-hydroxypiperidin-3-yl)methylcarbamoyl]phenyl]benzoate |
|---|---|
| PubChem CID | 119067850 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | methyl 2-[4-[(3-hydroxypiperidin-3-yl)methylcarbamoyl]phenyl]benzoate |
| SMILES | COC(=O)c1ccccc1-c1ccc(C(=O)NCC2(O)CCCNC2)cc1 |
| InChI | InChI=1S/C21H24N2O4/c1-27-20(25)18-6-3-2-5-17(18)15-7-9-16(10-8-15)19(24)23-14-21(26)11-4-12-22-13-21/h2-3,5-10,22,26H,4,11-14H2,1H3,(H,23,24) |
| InChIKey | PDBIJVZXNJFIDS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |