C13H13ClF3NO3 — CID 129399312
3-chloro-N-[[(3S)-3-hydroxyoxolan-3-yl]methyl]-5-(trifluoromethyl)benzamide (PubChem CID 129399312) has the molecular formula C13H13ClF3NO3 and a molecular weight of 323.70 g/mol. Its IUPAC name is 3-chloro-N-[[(3S)-3-hydroxyoxolan-3-yl]methyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 3-chloro-N-[[(3S)-3-hydroxyoxolan-3-yl]methyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 129399312 |
| Molecular Formula | C13H13ClF3NO3 |
| Molecular Weight | 323.70 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 3-chloro-N-[[(3S)-3-hydroxyoxolan-3-yl]methyl]-5-(trifluoromethyl)benzamide |
| SMILES | O=C(NC[C@@]1(O)CCOC1)c1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13ClF3NO3/c14-10-4-8(3-9(5-10)13(15,16)17)11(19)18-6-12(20)1-2-21-7-12/h3-5,20H,1-2,6-7H2,(H,18,19)/t12-/m0/s1 |
| InChIKey | WNXBSGIMGCGLTG-LBPRGKRZSA-N |
| XLogP | 2.24 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.70 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |