C10H13NO4 — CID 103848998
N-[(3-hydroxyoxolan-3-yl)methyl]furan-3-carboxamide (PubChem CID 103848998) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is N-[(3-hydroxyoxolan-3-yl)methyl]furan-3-carboxamide.
| Compound Name | N-[(3-hydroxyoxolan-3-yl)methyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 103848998 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | N-[(3-hydroxyoxolan-3-yl)methyl]furan-3-carboxamide |
| SMILES | O=C(NCC1(O)CCOC1)c1ccoc1 |
| InChI | InChI=1S/C10H13NO4/c12-9(8-1-3-14-5-8)11-6-10(13)2-4-15-7-10/h1,3,5,13H,2,4,6-7H2,(H,11,12) |
| InChIKey | BBCPVTOOIMIHHK-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |