C11H14N2O5 — CID 106102857
2-hydroxy-N-[(3-hydroxyoxolan-3-yl)methyl]-6-oxo-1H-pyridine-4-carboxamide (PubChem CID 106102857) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is 2-hydroxy-N-[(3-hydroxyoxolan-3-yl)methyl]-6-oxo-1H-pyridine-4-carboxamide.
| Compound Name | 2-hydroxy-N-[(3-hydroxyoxolan-3-yl)methyl]-6-oxo-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 106102857 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-hydroxy-N-[(3-hydroxyoxolan-3-yl)methyl]-6-oxo-1H-pyridine-4-carboxamide |
| SMILES | O=C(NCC1(O)CCOC1)c1cc(O)[nH]c(=O)c1 |
| InChI | InChI=1S/C11H14N2O5/c14-8-3-7(4-9(15)13-8)10(16)12-5-11(17)1-2-18-6-11/h3-4,17H,1-2,5-6H2,(H,12,16)(H2,13,14,15) |
| InChIKey | LWZDHKKLGYHGIA-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |