C13H17F3N2O3S — CID 122572400
N-[(3-hydroxypiperidin-3-yl)methyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 122572400) has the molecular formula C13H17F3N2O3S and a molecular weight of 338.35 g/mol. Its IUPAC name is N-[(3-hydroxypiperidin-3-yl)methyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(3-hydroxypiperidin-3-yl)methyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 122572400 |
| Molecular Formula | C13H17F3N2O3S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | N-[(3-hydroxypiperidin-3-yl)methyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1(O)CCCNC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F3N2O3S/c14-13(15,16)10-3-1-4-11(7-10)22(20,21)18-9-12(19)5-2-6-17-8-12/h1,3-4,7,17-19H,2,5-6,8-9H2 |
| InChIKey | SWVVJNVJKCUAJB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |