C13H14F3NO — CID 113234698
N-[(2,2-dimethylcyclopropyl)methyl]-3,4,5-trifluorobenzamide (PubChem CID 113234698) has the molecular formula C13H14F3NO and a molecular weight of 257.25 g/mol. Its IUPAC name is N-[(2,2-dimethylcyclopropyl)methyl]-3,4,5-trifluorobenzamide.
| Compound Name | N-[(2,2-dimethylcyclopropyl)methyl]-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 113234698 |
| Molecular Formula | C13H14F3NO |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-[(2,2-dimethylcyclopropyl)methyl]-3,4,5-trifluorobenzamide |
| SMILES | CC1(C)CC1CNC(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H14F3NO/c1-13(2)5-8(13)6-17-12(18)7-3-9(14)11(16)10(15)4-7/h3-4,8H,5-6H2,1-2H3,(H,17,18) |
| InChIKey | BRXWXZNXKUOPHU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|