C8H17N3O2 — CID 114760994
3-[(3-hydroxypyrrolidin-3-yl)methyl]-1,1-dimethylurea (PubChem CID 114760994) has the molecular formula C8H17N3O2 and a molecular weight of 187.24 g/mol. Its IUPAC name is 3-[(3-hydroxypyrrolidin-3-yl)methyl]-1,1-dimethylurea.
| Compound Name | 3-[(3-hydroxypyrrolidin-3-yl)methyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 114760994 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 3-[(3-hydroxypyrrolidin-3-yl)methyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCC1(O)CCNC1 |
| InChI | InChI=1S/C8H17N3O2/c1-11(2)7(12)10-6-8(13)3-4-9-5-8/h9,13H,3-6H2,1-2H3,(H,10,12) |
| InChIKey | OOANUDWKOGNWRN-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |