C10H12Cl2N2O3S — CID 114189630
2,5-dichloro-N-[(3-hydroxyazetidin-3-yl)methyl]benzenesulfonamide (PubChem CID 114189630) has the molecular formula C10H12Cl2N2O3S and a molecular weight of 311.19 g/mol. Its IUPAC name is 2,5-dichloro-N-[(3-hydroxyazetidin-3-yl)methyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[(3-hydroxyazetidin-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 114189630 |
| Molecular Formula | C10H12Cl2N2O3S |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 2,5-dichloro-N-[(3-hydroxyazetidin-3-yl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1(O)CNC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H12Cl2N2O3S/c11-7-1-2-8(12)9(3-7)18(16,17)14-6-10(15)4-13-5-10/h1-3,13-15H,4-6H2 |
| InChIKey | XWCDLZKCXPOPQU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |