C20H28N2O — CID 2873785
1-[(3,5-dimethyl-1-adamantyl)methyl]-3-phenylurea (PubChem CID 2873785) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1-adamantyl)methyl]-3-phenylurea.
| Compound Name | 1-[(3,5-dimethyl-1-adamantyl)methyl]-3-phenylurea |
|---|---|
| PubChem CID | 2873785 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 1-[(3,5-dimethyl-1-adamantyl)methyl]-3-phenylurea |
| SMILES | CC12CC3CC(C)(C1)CC(CNC(=O)Nc1ccccc1)(C3)C2 |
| InChI | InChI=1S/C20H28N2O/c1-18-8-15-9-19(2,11-18)13-20(10-15,12-18)14-21-17(23)22-16-6-4-3-5-7-16/h3-7,15H,8-14H2,1-2H3,(H2,21,22,23) |
| InChIKey | AWFPJXMTBLIVOQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |