C20H27NO — CID 98095522
N-[[(3R,5R)-3,5-dimethyl-1-adamantyl]methyl]benzamide (PubChem CID 98095522) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is N-[[(3R,5R)-3,5-dimethyl-1-adamantyl]methyl]benzamide.
| Compound Name | N-[[(3R,5R)-3,5-dimethyl-1-adamantyl]methyl]benzamide |
|---|---|
| PubChem CID | 98095522 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | N-[[(3R,5R)-3,5-dimethyl-1-adamantyl]methyl]benzamide |
| SMILES | C[C@]12CC3CC(CNC(=O)c4ccccc4)(C1)C[C@](C)(C3)C2 |
| InChI | InChI=1S/C20H27NO/c1-18-8-15-9-19(2,11-18)13-20(10-15,12-18)14-21-17(22)16-6-4-3-5-7-16/h3-7,15H,8-14H2,1-2H3,(H,21,22)/t15?,18-,19-,20?/m1/s1 |
| InChIKey | VDRKYEGHGBJMJA-QJTDPOQLSA-N |
| XLogP | 4.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |