C26H29N3O — CID 163397695
N-(1-adamantylmethyl)-2-benzyl-3H-benzimidazole-5-carboxamide (PubChem CID 163397695) has the molecular formula C26H29N3O and a molecular weight of 399.54 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-benzyl-3H-benzimidazole-5-carboxamide.
| Compound Name | N-(1-adamantylmethyl)-2-benzyl-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 163397695 |
| Molecular Formula | C26H29N3O |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | N-(1-adamantylmethyl)-2-benzyl-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)c1ccc2nc(Cc3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C26H29N3O/c30-25(27-16-26-13-18-8-19(14-26)10-20(9-18)15-26)21-6-7-22-23(12-21)29-24(28-22)11-17-4-2-1-3-5-17/h1-7,12,18-20H,8-11,13-16H2,(H,27,30)(H,28,29) |
| InChIKey | AFDZGSLQIBMFSH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |