C22H16Cl2N4O — CID 110526697
2-benzyl-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-3H-benzimidazole-5-carboxamide (PubChem CID 110526697) has the molecular formula C22H16Cl2N4O and a molecular weight of 423.30 g/mol. Its IUPAC name is 2-benzyl-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-benzyl-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 110526697 |
| Molecular Formula | C22H16Cl2N4O |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | 2-benzyl-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(Cl)c(Cl)c1)c1ccc2nc(Cc3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C22H16Cl2N4O/c23-17-8-6-15(10-18(17)24)13-25-28-22(29)16-7-9-19-20(12-16)27-21(26-19)11-14-4-2-1-3-5-14/h1-10,12-13H,11H2,(H,26,27)(H,28,29)/b25-13- |
| InChIKey | BQWIIUZPZDKSCM-MXAYSNPKSA-N |
| XLogP | 5.22 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|