C22H18N4O2 — CID 110526709
2-benzyl-N-[(Z)-(3-hydroxyphenyl)methylideneamino]-3H-benzimidazole-5-carboxamide (PubChem CID 110526709) has the molecular formula C22H18N4O2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-benzyl-N-[(Z)-(3-hydroxyphenyl)methylideneamino]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-benzyl-N-[(Z)-(3-hydroxyphenyl)methylideneamino]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 110526709 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-benzyl-N-[(Z)-(3-hydroxyphenyl)methylideneamino]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(N/N=C\c1cccc(O)c1)c1ccc2nc(Cc3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C22H18N4O2/c27-18-8-4-7-16(11-18)14-23-26-22(28)17-9-10-19-20(13-17)25-21(24-19)12-15-5-2-1-3-6-15/h1-11,13-14,27H,12H2,(H,24,25)(H,26,28)/b23-14- |
| InChIKey | CQKVMZLSTWCWJN-UCQKPKSFSA-N |
| XLogP | 3.62 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|