C25H24N4O3 — CID 110526518
N-[(Z)-(4-ethoxyphenyl)methylideneamino]-2-[(4-methoxyphenyl)methyl]-3H-benzimidazole-5-carboxamide (PubChem CID 110526518) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[(Z)-(4-ethoxyphenyl)methylideneamino]-2-[(4-methoxyphenyl)methyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[(Z)-(4-ethoxyphenyl)methylideneamino]-2-[(4-methoxyphenyl)methyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 110526518 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N-[(Z)-(4-ethoxyphenyl)methylideneamino]-2-[(4-methoxyphenyl)methyl]-3H-benzimidazole-5-carboxamide |
| SMILES | CCOc1ccc(/C=N\NC(=O)c2ccc3nc(Cc4ccc(OC)cc4)[nH]c3c2)cc1 |
| InChI | InChI=1S/C25H24N4O3/c1-3-32-21-11-6-18(7-12-21)16-26-29-25(30)19-8-13-22-23(15-19)28-24(27-22)14-17-4-9-20(31-2)10-5-17/h4-13,15-16H,3,14H2,1-2H3,(H,27,28)(H,29,30)/b26-16- |
| InChIKey | QXVPTHYADQBELA-QQXSKIMKSA-N |
| XLogP | 4.32 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|