C24H20N4O3 — CID 110526655
[4-[(Z)-[(2-benzyl-3H-benzimidazole-5-carbonyl)hydrazinylidene]methyl]phenyl] acetate (PubChem CID 110526655) has the molecular formula C24H20N4O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is [4-[(Z)-[(2-benzyl-3H-benzimidazole-5-carbonyl)hydrazinylidene]methyl]phenyl] acetate.
| Compound Name | [4-[(Z)-[(2-benzyl-3H-benzimidazole-5-carbonyl)hydrazinylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 110526655 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | [4-[(Z)-[(2-benzyl-3H-benzimidazole-5-carbonyl)hydrazinylidene]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(/C=N\NC(=O)c2ccc3nc(Cc4ccccc4)[nH]c3c2)cc1 |
| InChI | InChI=1S/C24H20N4O3/c1-16(29)31-20-10-7-18(8-11-20)15-25-28-24(30)19-9-12-21-22(14-19)27-23(26-21)13-17-5-3-2-4-6-17/h2-12,14-15H,13H2,1H3,(H,26,27)(H,28,30)/b25-15- |
| InChIKey | VKDUCUKJJJRFGU-MYYYXRDXSA-N |
| XLogP | 3.84 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|