C24H19F3N4O2 — CID 110526516
2-[(4-methoxyphenyl)methyl]-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]-3H-benzimidazole-5-carboxamide (PubChem CID 110526516) has the molecular formula C24H19F3N4O2 and a molecular weight of 452.44 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 110526516 |
| Molecular Formula | C24H19F3N4O2 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-N-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]-3H-benzimidazole-5-carboxamide |
| SMILES | COc1ccc(Cc2nc3ccc(C(=O)N/N=C\c4cccc(C(F)(F)F)c4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C24H19F3N4O2/c1-33-19-8-5-15(6-9-19)12-22-29-20-10-7-17(13-21(20)30-22)23(32)31-28-14-16-3-2-4-18(11-16)24(25,26)27/h2-11,13-14H,12H2,1H3,(H,29,30)(H,31,32)/b28-14- |
| InChIKey | MKBXURCZWGEVOT-MUXKCCDJSA-N |
| XLogP | 4.95 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|