C24H21N5O5 — CID 110526503
2-[(3,4-dimethoxyphenyl)methyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]-3H-benzimidazole-5-carboxamide (PubChem CID 110526503) has the molecular formula C24H21N5O5 and a molecular weight of 459.46 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 110526503 |
| Molecular Formula | C24H21N5O5 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]-3H-benzimidazole-5-carboxamide |
| SMILES | COc1ccc(Cc2nc3ccc(C(=O)N/N=C\c4ccc([N+](=O)[O-])cc4)cc3[nH]2)cc1OC |
| InChI | InChI=1S/C24H21N5O5/c1-33-21-10-5-16(11-22(21)34-2)12-23-26-19-9-6-17(13-20(19)27-23)24(30)28-25-14-15-3-7-18(8-4-15)29(31)32/h3-11,13-14H,12H2,1-2H3,(H,26,27)(H,28,30)/b25-14- |
| InChIKey | NUMBTZXJGVUBMS-QFEZKATASA-N |
| XLogP | 3.84 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|