C18H23ClN2O — CID 9032168
2-(1-adamantylamino)-N-(3-chlorophenyl)acetamide (PubChem CID 9032168) has the molecular formula C18H23ClN2O and a molecular weight of 318.85 g/mol. Its IUPAC name is 2-(1-adamantylamino)-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-(1-adamantylamino)-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 9032168 |
| Molecular Formula | C18H23ClN2O |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-(1-adamantylamino)-N-(3-chlorophenyl)acetamide |
| SMILES | O=C(CNC12CC3CC(CC(C3)C1)C2)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H23ClN2O/c19-15-2-1-3-16(7-15)21-17(22)11-20-18-8-12-4-13(9-18)6-14(5-12)10-18/h1-3,7,12-14,20H,4-6,8-11H2,(H,21,22) |
| InChIKey | JHLRVLFAMWMOCA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |