C18H30N2O — CID 81134526
(3S)-N-(3,5-dimethyl-1-adamantyl)piperidine-3-carboxamide (PubChem CID 81134526) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is (3S)-N-(3,5-dimethyl-1-adamantyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(3,5-dimethyl-1-adamantyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 81134526 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | (3S)-N-(3,5-dimethyl-1-adamantyl)piperidine-3-carboxamide |
| SMILES | CC12CC3CC(C)(C1)CC(NC(=O)[C@H]1CCCNC1)(C3)C2 |
| InChI | InChI=1S/C18H30N2O/c1-16-6-13-7-17(2,10-16)12-18(8-13,11-16)20-15(21)14-4-3-5-19-9-14/h13-14,19H,3-12H2,1-2H3,(H,20,21)/t13?,14-,16?,17?,18?/m0/s1 |
| InChIKey | IPJPGZMTINLDRV-LPWALBEISA-N |
| XLogP | 2.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |