C23H34N2O — CID 39951386
N-[(2R)-2-(dimethylamino)-2-(4-ethylphenyl)ethyl]adamantane-1-carboxamide (PubChem CID 39951386) has the molecular formula C23H34N2O and a molecular weight of 354.54 g/mol. Its IUPAC name is N-[(2R)-2-(dimethylamino)-2-(4-ethylphenyl)ethyl]adamantane-1-carboxamide.
| Compound Name | N-[(2R)-2-(dimethylamino)-2-(4-ethylphenyl)ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 39951386 |
| Molecular Formula | C23H34N2O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | N-[(2R)-2-(dimethylamino)-2-(4-ethylphenyl)ethyl]adamantane-1-carboxamide |
| SMILES | CCc1ccc([C@H](CNC(=O)C23CC4CC(CC(C4)C2)C3)N(C)C)cc1 |
| InChI | InChI=1S/C23H34N2O/c1-4-16-5-7-20(8-6-16)21(25(2)3)15-24-22(26)23-12-17-9-18(13-23)11-19(10-17)14-23/h5-8,17-19,21H,4,9-15H2,1-3H3,(H,24,26)/t17?,18?,19?,21-,23?/m0/s1 |
| InChIKey | IPEAZZLYNKBUBT-FCSDKFEESA-N |
| XLogP | 4.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |