C23H29NO5 — CID 7190646
(5-acetyl-2-methoxyphenyl)methyl 2-(adamantane-1-carbonylamino)acetate (PubChem CID 7190646) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is (5-acetyl-2-methoxyphenyl)methyl 2-(adamantane-1-carbonylamino)acetate.
| Compound Name | (5-acetyl-2-methoxyphenyl)methyl 2-(adamantane-1-carbonylamino)acetate |
|---|---|
| PubChem CID | 7190646 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (5-acetyl-2-methoxyphenyl)methyl 2-(adamantane-1-carbonylamino)acetate |
| SMILES | COc1ccc(C(C)=O)cc1COC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H29NO5/c1-14(25)18-3-4-20(28-2)19(8-18)13-29-21(26)12-24-22(27)23-9-15-5-16(10-23)7-17(6-15)11-23/h3-4,8,15-17H,5-7,9-13H2,1-2H3,(H,24,27) |
| InChIKey | XOILAYJVTSDBSZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |