C23H31N3O5 — CID 30870609
N-[3-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-3-oxopropyl]adamantane-1-carboxamide (PubChem CID 30870609) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[3-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-3-oxopropyl]adamantane-1-carboxamide.
| Compound Name | N-[3-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-3-oxopropyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 30870609 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | N-[3-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-3-oxopropyl]adamantane-1-carboxamide |
| SMILES | COc1ccc(C(=O)NNC(=O)CCNC(=O)C23CC4CC(CC(C4)C2)C3)cc1OC |
| InChI | InChI=1S/C23H31N3O5/c1-30-18-4-3-17(10-19(18)31-2)21(28)26-25-20(27)5-6-24-22(29)23-11-14-7-15(12-23)9-16(8-14)13-23/h3-4,10,14-16H,5-9,11-13H2,1-2H3,(H,24,29)(H,25,27)(H,26,28) |
| InChIKey | GURLPWJNLADRFM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|