C24H28N2O5 — CID 7755481
2-(1,3-dioxoisoindol-2-yl)ethyl 2-[[2-(1-adamantyl)acetyl]amino]acetate (PubChem CID 7755481) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[[2-(1-adamantyl)acetyl]amino]acetate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[[2-(1-adamantyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 7755481 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[[2-(1-adamantyl)acetyl]amino]acetate |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NCC(=O)OCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H28N2O5/c27-20(13-24-10-15-7-16(11-24)9-17(8-15)12-24)25-14-21(28)31-6-5-26-22(29)18-3-1-2-4-19(18)23(26)30/h1-4,15-17H,5-14H2,(H,25,27) |
| InChIKey | RJHKTCZTZDWQKU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|