C25H29NO — CID 98158809
2,2-diphenyl-N-[(1R,8R)-3-tricyclo[4.3.1.13,8]undecanyl]acetamide (PubChem CID 98158809) has the molecular formula C25H29NO and a molecular weight of 359.51 g/mol. Its IUPAC name is 2,2-diphenyl-N-[(1R,8R)-3-tricyclo[4.3.1.13,8]undecanyl]acetamide.
| Compound Name | 2,2-diphenyl-N-[(1R,8R)-3-tricyclo[4.3.1.13,8]undecanyl]acetamide |
|---|---|
| PubChem CID | 98158809 |
| Molecular Formula | C25H29NO |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 2,2-diphenyl-N-[(1R,8R)-3-tricyclo[4.3.1.13,8]undecanyl]acetamide |
| SMILES | O=C(NC12CCC3C[C@H](C[C@@H](C3)C1)C2)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H29NO/c27-24(23(21-7-3-1-4-8-21)22-9-5-2-6-10-22)26-25-12-11-18-13-19(16-25)15-20(14-18)17-25/h1-10,18-20,23H,11-17H2,(H,26,27)/t18?,19-,20-,25?/m1/s1 |
| InChIKey | CRBOISRBMOGBOA-PRFRBYCISA-N |
| XLogP | 5.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |