C25H26N2O2 — CID 112992893
N-[2-[benzyl(ethyl)amino]-2-oxoethyl]-2,2-diphenylacetamide (PubChem CID 112992893) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-[2-[benzyl(ethyl)amino]-2-oxoethyl]-2,2-diphenylacetamide.
| Compound Name | N-[2-[benzyl(ethyl)amino]-2-oxoethyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 112992893 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-[2-[benzyl(ethyl)amino]-2-oxoethyl]-2,2-diphenylacetamide |
| SMILES | CCN(Cc1ccccc1)C(=O)CNC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O2/c1-2-27(19-20-12-6-3-7-13-20)23(28)18-26-25(29)24(21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17,24H,2,18-19H2,1H3,(H,26,29) |
| InChIKey | VJTWGUNOPOLKEN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |