C23H31N3O2 — CID 113053769
N-[2-[acetyl-[3-(dimethylamino)propyl]amino]ethyl]-2,2-diphenylacetamide (PubChem CID 113053769) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is N-[2-[acetyl-[3-(dimethylamino)propyl]amino]ethyl]-2,2-diphenylacetamide.
| Compound Name | N-[2-[acetyl-[3-(dimethylamino)propyl]amino]ethyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 113053769 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | N-[2-[acetyl-[3-(dimethylamino)propyl]amino]ethyl]-2,2-diphenylacetamide |
| SMILES | CC(=O)N(CCCN(C)C)CCNC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31N3O2/c1-19(27)26(17-10-16-25(2)3)18-15-24-23(28)22(20-11-6-4-7-12-20)21-13-8-5-9-14-21/h4-9,11-14,22H,10,15-18H2,1-3H3,(H,24,28) |
| InChIKey | IXLPRLUPSKZECH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |