C14H30N4O2 — CID 113117818
3-[acetyl-[3-(dimethylamino)propyl]amino]-N-[2-(dimethylamino)ethyl]propanamide (PubChem CID 113117818) has the molecular formula C14H30N4O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is 3-[acetyl-[3-(dimethylamino)propyl]amino]-N-[2-(dimethylamino)ethyl]propanamide.
| Compound Name | 3-[acetyl-[3-(dimethylamino)propyl]amino]-N-[2-(dimethylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 113117818 |
| Molecular Formula | C14H30N4O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 3-[acetyl-[3-(dimethylamino)propyl]amino]-N-[2-(dimethylamino)ethyl]propanamide |
| SMILES | CC(=O)N(CCCN(C)C)CCC(=O)NCCN(C)C |
| InChI | InChI=1S/C14H30N4O2/c1-13(19)18(10-6-9-16(2)3)11-7-14(20)15-8-12-17(4)5/h6-12H2,1-5H3,(H,15,20) |
| InChIKey | GSXJZUJDIRRMFK-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |