C13H28N4O2 — CID 113117461
3-[acetyl-[2-(dimethylamino)ethyl]amino]-N-[2-(dimethylamino)ethyl]propanamide (PubChem CID 113117461) has the molecular formula C13H28N4O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 3-[acetyl-[2-(dimethylamino)ethyl]amino]-N-[2-(dimethylamino)ethyl]propanamide.
| Compound Name | 3-[acetyl-[2-(dimethylamino)ethyl]amino]-N-[2-(dimethylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 113117461 |
| Molecular Formula | C13H28N4O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | 3-[acetyl-[2-(dimethylamino)ethyl]amino]-N-[2-(dimethylamino)ethyl]propanamide |
| SMILES | CC(=O)N(CCC(=O)NCCN(C)C)CCN(C)C |
| InChI | InChI=1S/C13H28N4O2/c1-12(18)17(11-10-16(4)5)8-6-13(19)14-7-9-15(2)3/h6-11H2,1-5H3,(H,14,19) |
| InChIKey | PKBSYIRZTIQSMD-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |