C23H31N2O+ — CID 9051562
N-[3-(4-methylpiperidin-1-ium-1-yl)propyl]-2,2-diphenylacetamide (PubChem CID 9051562) has the molecular formula C23H31N2O+ and a molecular weight of 351.51 g/mol. Its IUPAC name is N-[3-(4-methylpiperidin-1-ium-1-yl)propyl]-2,2-diphenylacetamide.
| Compound Name | N-[3-(4-methylpiperidin-1-ium-1-yl)propyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 9051562 |
| Molecular Formula | C23H31N2O+ |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | N-[3-(4-methylpiperidin-1-ium-1-yl)propyl]-2,2-diphenylacetamide |
| SMILES | CC1CC[NH+](CCCNC(=O)C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H30N2O/c1-19-13-17-25(18-14-19)16-8-15-24-23(26)22(20-9-4-2-5-10-20)21-11-6-3-7-12-21/h2-7,9-12,19,22H,8,13-18H2,1H3,(H,24,26)/p+1 |
| InChIKey | JNCUKZPZGPEJSL-UHFFFAOYSA-O |
| XLogP | 2.64 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|