C15H22N3O2+ — CID 8557739
(2S)-N-carbamoyl-2-(4-methylpiperidin-1-ium-1-yl)-2-phenylacetamide (PubChem CID 8557739) has the molecular formula C15H22N3O2+ and a molecular weight of 276.36 g/mol. Its IUPAC name is (2S)-N-carbamoyl-2-(4-methylpiperidin-1-ium-1-yl)-2-phenylacetamide.
| Compound Name | (2S)-N-carbamoyl-2-(4-methylpiperidin-1-ium-1-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 8557739 |
| Molecular Formula | C15H22N3O2+ |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (2S)-N-carbamoyl-2-(4-methylpiperidin-1-ium-1-yl)-2-phenylacetamide |
| SMILES | CC1CC[NH+]([C@H](C(=O)NC(N)=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C15H21N3O2/c1-11-7-9-18(10-8-11)13(14(19)17-15(16)20)12-5-3-2-4-6-12/h2-6,11,13H,7-10H2,1H3,(H3,16,17,19,20)/p+1/t13-/m0/s1 |
| InChIKey | CTVVQLVDQLGYOM-ZDUSSCGKSA-O |
| XLogP | 0.24 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |