C18H22N3O2+ — CID 8516766
[(1R)-2-(carbamoylamino)-2-oxo-1-phenylethyl]-methyl-[(2-methylphenyl)methyl]azanium (PubChem CID 8516766) has the molecular formula C18H22N3O2+ and a molecular weight of 312.39 g/mol. Its IUPAC name is [(1R)-2-(carbamoylamino)-2-oxo-1-phenylethyl]-methyl-[(2-methylphenyl)methyl]azanium.
| Compound Name | [(1R)-2-(carbamoylamino)-2-oxo-1-phenylethyl]-methyl-[(2-methylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 8516766 |
| Molecular Formula | C18H22N3O2+ |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | [(1R)-2-(carbamoylamino)-2-oxo-1-phenylethyl]-methyl-[(2-methylphenyl)methyl]azanium |
| SMILES | Cc1ccccc1C[NH+](C)[C@@H](C(=O)NC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C18H21N3O2/c1-13-8-6-7-11-15(13)12-21(2)16(17(22)20-18(19)23)14-9-4-3-5-10-14/h3-11,16H,12H2,1-2H3,(H3,19,20,22,23)/p+1/t16-/m1/s1 |
| InChIKey | XMKLMYMQRBYTBB-MRXNPFEDSA-O |
| XLogP | 0.95 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |