C19H23ClN3O2+ — CID 8540301
(4-chlorophenyl)methyl-[(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl]-methylazanium (PubChem CID 8540301) has the molecular formula C19H23ClN3O2+ and a molecular weight of 360.87 g/mol. Its IUPAC name is (4-chlorophenyl)methyl-[(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl]-methylazanium.
| Compound Name | (4-chlorophenyl)methyl-[(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl]-methylazanium |
|---|---|
| PubChem CID | 8540301 |
| Molecular Formula | C19H23ClN3O2+ |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (4-chlorophenyl)methyl-[(1S)-2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl]-methylazanium |
| SMILES | CCNC(=O)NC(=O)[C@H](c1ccccc1)[NH+](C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClN3O2/c1-3-21-19(25)22-18(24)17(15-7-5-4-6-8-15)23(2)13-14-9-11-16(20)12-10-14/h4-12,17H,3,13H2,1-2H3,(H2,21,22,24,25)/p+1/t17-/m0/s1 |
| InChIKey | KFEAIZFBKBJNMZ-KRWDZBQOSA-O |
| XLogP | 1.94 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |