C15H17BrN3O2S+ — CID 8971597
(5-bromothiophen-2-yl)methyl-[(1R)-2-(carbamoylamino)-2-oxo-1-phenylethyl]-methylazanium (PubChem CID 8971597) has the molecular formula C15H17BrN3O2S+ and a molecular weight of 383.29 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)methyl-[(1R)-2-(carbamoylamino)-2-oxo-1-phenylethyl]-methylazanium.
| Compound Name | (5-bromothiophen-2-yl)methyl-[(1R)-2-(carbamoylamino)-2-oxo-1-phenylethyl]-methylazanium |
|---|---|
| PubChem CID | 8971597 |
| Molecular Formula | C15H17BrN3O2S+ |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | (5-bromothiophen-2-yl)methyl-[(1R)-2-(carbamoylamino)-2-oxo-1-phenylethyl]-methylazanium |
| SMILES | C[NH+](Cc1ccc(Br)s1)[C@@H](C(=O)NC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C15H16BrN3O2S/c1-19(9-11-7-8-12(16)22-11)13(14(20)18-15(17)21)10-5-3-2-4-6-10/h2-8,13H,9H2,1H3,(H3,17,18,20,21)/p+1/t13-/m1/s1 |
| InChIKey | RYJSZZGRVNDIIK-CYBMUJFWSA-O |
| XLogP | 1.46 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |