C16H21N2O+ — CID 7389120
(2S)-4-(4-methylpiperidin-1-ium-1-yl)-3-oxo-2-phenylbutanenitrile (PubChem CID 7389120) has the molecular formula C16H21N2O+ and a molecular weight of 257.36 g/mol. Its IUPAC name is (2S)-4-(4-methylpiperidin-1-ium-1-yl)-3-oxo-2-phenylbutanenitrile.
| Compound Name | (2S)-4-(4-methylpiperidin-1-ium-1-yl)-3-oxo-2-phenylbutanenitrile |
|---|---|
| PubChem CID | 7389120 |
| Molecular Formula | C16H21N2O+ |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | (2S)-4-(4-methylpiperidin-1-ium-1-yl)-3-oxo-2-phenylbutanenitrile |
| SMILES | CC1CC[NH+](CC(=O)[C@H](C#N)c2ccccc2)CC1 |
| InChI | InChI=1S/C16H20N2O/c1-13-7-9-18(10-8-13)12-16(19)15(11-17)14-5-3-2-4-6-14/h2-6,13,15H,7-10,12H2,1H3/p+1/t15-/m1/s1 |
| InChIKey | MWWQDTLCATVFMN-OAHLLOKOSA-O |
| XLogP | 1.18 |
| TPSA | 45.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |