C15H17NO — CID 107179005
3-(2-methylcyclopentyl)-3-oxo-2-phenylpropanenitrile (PubChem CID 107179005) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 3-(2-methylcyclopentyl)-3-oxo-2-phenylpropanenitrile.
| Compound Name | 3-(2-methylcyclopentyl)-3-oxo-2-phenylpropanenitrile |
|---|---|
| PubChem CID | 107179005 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 3-(2-methylcyclopentyl)-3-oxo-2-phenylpropanenitrile |
| SMILES | CC1CCCC1C(=O)C(C#N)c1ccccc1 |
| InChI | InChI=1S/C15H17NO/c1-11-6-5-9-13(11)15(17)14(10-16)12-7-3-2-4-8-12/h2-4,7-8,11,13-14H,5-6,9H2,1H3 |
| InChIKey | XZDRYTSPYMLUEU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |