C18H25N4O2S+ — CID 7098101
2-(4-methylanilino)-N-(3-morpholin-4-ium-4-ylpropyl)-1,3-thiazole-4-carboxamide (PubChem CID 7098101) has the molecular formula C18H25N4O2S+ and a molecular weight of 361.49 g/mol. Its IUPAC name is 2-(4-methylanilino)-N-(3-morpholin-4-ium-4-ylpropyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(4-methylanilino)-N-(3-morpholin-4-ium-4-ylpropyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 7098101 |
| Molecular Formula | C18H25N4O2S+ |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 2-(4-methylanilino)-N-(3-morpholin-4-ium-4-ylpropyl)-1,3-thiazole-4-carboxamide |
| SMILES | Cc1ccc(Nc2nc(C(=O)NCCC[NH+]3CCOCC3)cs2)cc1 |
| InChI | InChI=1S/C18H24N4O2S/c1-14-3-5-15(6-4-14)20-18-21-16(13-25-18)17(23)19-7-2-8-22-9-11-24-12-10-22/h3-6,13H,2,7-12H2,1H3,(H,19,23)(H,20,21)/p+1 |
| InChIKey | ZWACMYYIRSHNGO-UHFFFAOYSA-O |
| XLogP | 1.23 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|