C22H29N4O2S+ — CID 9411481
1-(3-morpholin-4-ium-4-ylpropyl)-3-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]thiourea (PubChem CID 9411481) has the molecular formula C22H29N4O2S+ and a molecular weight of 413.57 g/mol. Its IUPAC name is 1-(3-morpholin-4-ium-4-ylpropyl)-3-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-(3-morpholin-4-ium-4-ylpropyl)-3-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 9411481 |
| Molecular Formula | C22H29N4O2S+ |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 1-(3-morpholin-4-ium-4-ylpropyl)-3-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]thiourea |
| SMILES | S=C(NCCC[NH+]1CCOCC1)N/N=C\c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H28N4O2S/c29-22(23-11-4-12-26-13-15-27-16-14-26)25-24-17-19-7-9-21(10-8-19)28-18-20-5-2-1-3-6-20/h1-3,5-10,17H,4,11-16,18H2,(H2,23,25,29)/p+1/b24-17- |
| InChIKey | LBOFIXNNHVDBLY-ULJHMMPZSA-O |
| XLogP | 1.37 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|