C19H30N5O4S+ — CID 7934102
N-ethyl-2-[2-methoxy-4-[(Z)-(2-morpholin-4-ium-4-ylethylcarbamothioylhydrazinylidene)methyl]phenoxy]acetamide (PubChem CID 7934102) has the molecular formula C19H30N5O4S+ and a molecular weight of 424.55 g/mol. Its IUPAC name is N-ethyl-2-[2-methoxy-4-[(Z)-(2-morpholin-4-ium-4-ylethylcarbamothioylhydrazinylidene)methyl]phenoxy]acetamide.
| Compound Name | N-ethyl-2-[2-methoxy-4-[(Z)-(2-morpholin-4-ium-4-ylethylcarbamothioylhydrazinylidene)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 7934102 |
| Molecular Formula | C19H30N5O4S+ |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | N-ethyl-2-[2-methoxy-4-[(Z)-(2-morpholin-4-ium-4-ylethylcarbamothioylhydrazinylidene)methyl]phenoxy]acetamide |
| SMILES | CCNC(=O)COc1ccc(/C=N\NC(=S)NCC[NH+]2CCOCC2)cc1OC |
| InChI | InChI=1S/C19H29N5O4S/c1-3-20-18(25)14-28-16-5-4-15(12-17(16)26-2)13-22-23-19(29)21-6-7-24-8-10-27-11-9-24/h4-5,12-13H,3,6-11,14H2,1-2H3,(H,20,25)(H2,21,23,29)/p+1/b22-13- |
| InChIKey | FNDVAIBWYSQJEX-XKZIYDEJSA-O |
| XLogP | -1.08 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|