C23H30N4O4 — CID 7928987
4-(diethylamino)-N-[(Z)-[4-[2-(ethylamino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]benzamide (PubChem CID 7928987) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is 4-(diethylamino)-N-[(Z)-[4-[2-(ethylamino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]benzamide.
| Compound Name | 4-(diethylamino)-N-[(Z)-[4-[2-(ethylamino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 7928987 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 4-(diethylamino)-N-[(Z)-[4-[2-(ethylamino)-2-oxoethoxy]-3-methoxyphenyl]methylideneamino]benzamide |
| SMILES | CCNC(=O)COc1ccc(/C=N\NC(=O)c2ccc(N(CC)CC)cc2)cc1OC |
| InChI | InChI=1S/C23H30N4O4/c1-5-24-22(28)16-31-20-13-8-17(14-21(20)30-4)15-25-26-23(29)18-9-11-19(12-10-18)27(6-2)7-3/h8-15H,5-7,16H2,1-4H3,(H,24,28)(H,26,29)/b25-15- |
| InChIKey | MPAGSCAODYWUTE-MYYYXRDXSA-N |
| XLogP | 2.82 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|