C16H12F5N3O3 — CID 3949220
N-[1-[4-(difluoromethoxy)phenyl]ethylideneamino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 3949220) has the molecular formula C16H12F5N3O3 and a molecular weight of 389.28 g/mol. Its IUPAC name is N-[1-[4-(difluoromethoxy)phenyl]ethylideneamino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[1-[4-(difluoromethoxy)phenyl]ethylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 3949220 |
| Molecular Formula | C16H12F5N3O3 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | N-[1-[4-(difluoromethoxy)phenyl]ethylideneamino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | CC(=NNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H12F5N3O3/c1-9(10-2-5-12(6-3-10)27-15(17)18)22-23-13-7-4-11(16(19,20)21)8-14(13)24(25)26/h2-8,15,23H,1H3 |
| InChIKey | ZJICWXPTVRBLRT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|