C17H21F3N2O3 — CID 175520122
(3R)-1-[2,2-dimethyl-5-nitro-7-(trifluoromethyl)-3H-1-benzofuran-6-yl]-3-methylpiperidine (PubChem CID 175520122) has the molecular formula C17H21F3N2O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is (3R)-1-[2,2-dimethyl-5-nitro-7-(trifluoromethyl)-3H-1-benzofuran-6-yl]-3-methylpiperidine.
| Compound Name | (3R)-1-[2,2-dimethyl-5-nitro-7-(trifluoromethyl)-3H-1-benzofuran-6-yl]-3-methylpiperidine |
|---|---|
| PubChem CID | 175520122 |
| Molecular Formula | C17H21F3N2O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (3R)-1-[2,2-dimethyl-5-nitro-7-(trifluoromethyl)-3H-1-benzofuran-6-yl]-3-methylpiperidine |
| SMILES | C[C@@H]1CCCN(c2c([N+](=O)[O-])cc3c(c2C(F)(F)F)OC(C)(C)C3)C1 |
| InChI | InChI=1S/C17H21F3N2O3/c1-10-5-4-6-21(9-10)14-12(22(23)24)7-11-8-16(2,3)25-15(11)13(14)17(18,19)20/h7,10H,4-6,8-9H2,1-3H3/t10-/m1/s1 |
| InChIKey | BYROXSLOMTZFTE-SNVBAGLBSA-N |
| XLogP | 4.56 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|