C29H20F6N6O10 — CID 141184300
5-[2-[3-amino-4-[2,6-dinitro-4-(trifluoromethyl)phenoxy]phenyl]propan-2-yl]-2-[2,6-dinitro-4-(trifluoromethyl)phenoxy]aniline (PubChem CID 141184300) has the molecular formula C29H20F6N6O10 and a molecular weight of 726.50 g/mol. Its IUPAC name is 5-[2-[3-amino-4-[2,6-dinitro-4-(trifluoromethyl)phenoxy]phenyl]propan-2-yl]-2-[2,6-dinitro-4-(trifluoromethyl)phenoxy]aniline.
| Compound Name | 5-[2-[3-amino-4-[2,6-dinitro-4-(trifluoromethyl)phenoxy]phenyl]propan-2-yl]-2-[2,6-dinitro-4-(trifluoromethyl)phenoxy]aniline |
|---|---|
| PubChem CID | 141184300 |
| Molecular Formula | C29H20F6N6O10 |
| Molecular Weight | 726.50 g/mol |
| Exact Mass | 726.11 |
| IUPAC Name | 5-[2-[3-amino-4-[2,6-dinitro-4-(trifluoromethyl)phenoxy]phenyl]propan-2-yl]-2-[2,6-dinitro-4-(trifluoromethyl)phenoxy]aniline |
| SMILES | CC(C)(c1ccc(Oc2c([N+](=O)[O-])cc(C(F)(F)F)cc2[N+](=O)[O-])c(N)c1)c1ccc(Oc2c([N+](=O)[O-])cc(C(F)(F)F)cc2[N+](=O)[O-])c(N)c1 |
| InChI | InChI=1S/C29H20F6N6O10/c1-27(2,13-3-5-23(17(36)7-13)50-25-19(38(42)43)9-15(28(30,31)32)10-20(25)39(44)45)14-4-6-24(18(37)8-14)51-26-21(40(46)47)11-16(29(33,34)35)12-22(26)41(48)49/h3-12H,36-37H2,1-2H3 |
| InChIKey | OUQBXVVXYWJJNC-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 243.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.50 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|