C17H9F4N3O5 — CID 12798300
4-[2,6-dinitro-4-(trifluoromethyl)phenoxy]-6-fluoro-2-methylquinoline (PubChem CID 12798300) has the molecular formula C17H9F4N3O5 and a molecular weight of 411.27 g/mol. Its IUPAC name is 4-[2,6-dinitro-4-(trifluoromethyl)phenoxy]-6-fluoro-2-methylquinoline.
| Compound Name | 4-[2,6-dinitro-4-(trifluoromethyl)phenoxy]-6-fluoro-2-methylquinoline |
|---|---|
| PubChem CID | 12798300 |
| Molecular Formula | C17H9F4N3O5 |
| Molecular Weight | 411.27 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 4-[2,6-dinitro-4-(trifluoromethyl)phenoxy]-6-fluoro-2-methylquinoline |
| SMILES | Cc1cc(Oc2c([N+](=O)[O-])cc(C(F)(F)F)cc2[N+](=O)[O-])c2cc(F)ccc2n1 |
| InChI | InChI=1S/C17H9F4N3O5/c1-8-4-15(11-7-10(18)2-3-12(11)22-8)29-16-13(23(25)26)5-9(17(19,20)21)6-14(16)24(27)28/h2-7H,1H3 |
| InChIKey | SYRWHJYEFZYNNA-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 108.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.27 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|