C17H11F3N4O4 — CID 23477052
N-(2,4-dinitrophenyl)-2-methyl-7-(trifluoromethyl)quinolin-4-amine (PubChem CID 23477052) has the molecular formula C17H11F3N4O4 and a molecular weight of 392.29 g/mol. Its IUPAC name is N-(2,4-dinitrophenyl)-2-methyl-7-(trifluoromethyl)quinolin-4-amine.
| Compound Name | N-(2,4-dinitrophenyl)-2-methyl-7-(trifluoromethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 23477052 |
| Molecular Formula | C17H11F3N4O4 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | N-(2,4-dinitrophenyl)-2-methyl-7-(trifluoromethyl)quinolin-4-amine |
| SMILES | Cc1cc(Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c2ccc(C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C17H11F3N4O4/c1-9-6-14(12-4-2-10(17(18,19)20)7-15(12)21-9)22-13-5-3-11(23(25)26)8-16(13)24(27)28/h2-8H,1H3,(H,21,22) |
| InChIKey | BSDKKACXGGFCEH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|