C12H11F3N4O2 — CID 133423152
1,5-dimethyl-N-[2-nitro-4-(trifluoromethyl)phenyl]pyrazol-3-amine (PubChem CID 133423152) has the molecular formula C12H11F3N4O2 and a molecular weight of 300.24 g/mol. Its IUPAC name is 1,5-dimethyl-N-[2-nitro-4-(trifluoromethyl)phenyl]pyrazol-3-amine.
| Compound Name | 1,5-dimethyl-N-[2-nitro-4-(trifluoromethyl)phenyl]pyrazol-3-amine |
|---|---|
| PubChem CID | 133423152 |
| Molecular Formula | C12H11F3N4O2 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1,5-dimethyl-N-[2-nitro-4-(trifluoromethyl)phenyl]pyrazol-3-amine |
| SMILES | Cc1cc(Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])nn1C |
| InChI | InChI=1S/C12H11F3N4O2/c1-7-5-11(17-18(7)2)16-9-4-3-8(12(13,14)15)6-10(9)19(20)21/h3-6H,1-2H3,(H,16,17) |
| InChIKey | JYTCPCRVCYTGHT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|