C24H16F6N4O10 — CID 141168910
2-[2-tert-butyl-3-[2,6-dinitro-4-(trifluoromethyl)phenoxy]phenoxy]-1,3-dinitro-5-(trifluoromethyl)benzene (PubChem CID 141168910) has the molecular formula C24H16F6N4O10 and a molecular weight of 634.40 g/mol. Its IUPAC name is 2-[2-tert-butyl-3-[2,6-dinitro-4-(trifluoromethyl)phenoxy]phenoxy]-1,3-dinitro-5-(trifluoromethyl)benzene.
| Compound Name | 2-[2-tert-butyl-3-[2,6-dinitro-4-(trifluoromethyl)phenoxy]phenoxy]-1,3-dinitro-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 141168910 |
| Molecular Formula | C24H16F6N4O10 |
| Molecular Weight | 634.40 g/mol |
| Exact Mass | 634.08 |
| IUPAC Name | 2-[2-tert-butyl-3-[2,6-dinitro-4-(trifluoromethyl)phenoxy]phenoxy]-1,3-dinitro-5-(trifluoromethyl)benzene |
| SMILES | CC(C)(C)c1c(Oc2c([N+](=O)[O-])cc(C(F)(F)F)cc2[N+](=O)[O-])cccc1Oc1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H16F6N4O10/c1-22(2,3)19-17(43-20-13(31(35)36)7-11(23(25,26)27)8-14(20)32(37)38)5-4-6-18(19)44-21-15(33(39)40)9-12(24(28,29)30)10-16(21)34(41)42/h4-10H,1-3H3 |
| InChIKey | NNVUMHBSGCLYAZ-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 191.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.40 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|